C27H28N4O6S — CID 25039679
N-(1-benzylpiperidin-4-yl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]furan-2-carboxamide (PubChem CID 25039679) has the molecular formula C27H28N4O6S and a molecular weight of 536.61 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]furan-2-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25039679 |
| Molecular Formula | C27H28N4O6S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]furan-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(C(=O)c3ccco3)C3CCN(Cc4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C27H28N4O6S/c28-38(35,36)22-10-8-20(9-11-22)31-25(32)17-23(26(31)33)30(27(34)24-7-4-16-37-24)21-12-14-29(15-13-21)18-19-5-2-1-3-6-19/h1-11,16,21,23H,12-15,17-18H2,(H2,28,35,36) |
| InChIKey | UHEODVMWVNDILJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|