C23H26N2O5 — CID 23802209
N-cyclohexyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide (PubChem CID 23802209) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-cyclohexyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide.
| Compound Name | N-cyclohexyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 23802209 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-cyclohexyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(C(=O)c3ccco3)C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H26N2O5/c1-2-29-18-12-10-17(11-13-18)25-21(26)15-19(22(25)27)24(16-7-4-3-5-8-16)23(28)20-9-6-14-30-20/h6,9-14,16,19H,2-5,7-8,15H2,1H3 |
| InChIKey | SFXHIKPZCZLBHK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|