C25H28N2O4 — CID 23887026
N-cycloheptyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-phenoxyacetamide (PubChem CID 23887026) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-cycloheptyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-phenoxyacetamide.
| Compound Name | N-cycloheptyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 23887026 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-cycloheptyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-phenoxyacetamide |
| SMILES | O=C1CC(N(C(=O)COc2ccccc2)C2CCCCCC2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C25H28N2O4/c28-23-17-22(25(30)27(23)20-13-7-3-8-14-20)26(19-11-5-1-2-6-12-19)24(29)18-31-21-15-9-4-10-16-21/h3-4,7-10,13-16,19,22H,1-2,5-6,11-12,17-18H2 |
| InChIKey | BPTLLVFGBSOWKN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|