C22H23BrN2O4 — CID 23802210
N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptylfuran-2-carboxamide (PubChem CID 23802210) has the molecular formula C22H23BrN2O4 and a molecular weight of 459.34 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptylfuran-2-carboxamide.
| Compound Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptylfuran-2-carboxamide |
|---|---|
| PubChem CID | 23802210 |
| Molecular Formula | C22H23BrN2O4 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptylfuran-2-carboxamide |
| SMILES | O=C1CC(N(C(=O)c2ccco2)C2CCCCCC2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H23BrN2O4/c23-15-9-11-17(12-10-15)25-20(26)14-18(21(25)27)24(16-6-3-1-2-4-7-16)22(28)19-8-5-13-29-19/h5,8-13,16,18H,1-4,6-7,14H2 |
| InChIKey | IQAXKQGOCKEITN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|