C19H19FN2O4 — CID 23859372
N-tert-butyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide (PubChem CID 23859372) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is N-tert-butyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide.
| Compound Name | N-tert-butyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 23859372 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-tert-butyl-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]furan-2-carboxamide |
| SMILES | CC(C)(C)N(C(=O)c1ccco1)C1CC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C19H19FN2O4/c1-19(2,3)22(18(25)15-5-4-10-26-15)14-11-16(23)21(17(14)24)13-8-6-12(20)7-9-13/h4-10,14H,11H2,1-3H3 |
| InChIKey | BYDHUFRRNFUYJY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|