C20H24N2O4S2 — CID 23998656
N-(2-methylbutan-2-yl)-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide (PubChem CID 23998656) has the molecular formula C20H24N2O4S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-(2-methylbutan-2-yl)-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-(2-methylbutan-2-yl)-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23998656 |
| Molecular Formula | C20H24N2O4S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-(2-methylbutan-2-yl)-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
| SMILES | CCC(C)(C)N(C1CC(=O)N(c2ccc(C)cc2)C1=O)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H24N2O4S2/c1-5-20(3,4)22(28(25,26)18-7-6-12-27-18)16-13-17(23)21(19(16)24)15-10-8-14(2)9-11-15/h6-12,16H,5,13H2,1-4H3 |
| InChIKey | KPWNZBXLVWVAIC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|