C21H23BrN2O4S — CID 23801800
4-bromo-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N-(2-methylbutan-2-yl)benzenesulfonamide (PubChem CID 23801800) has the molecular formula C21H23BrN2O4S and a molecular weight of 479.40 g/mol. Its IUPAC name is 4-bromo-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N-(2-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N-(2-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 23801800 |
| Molecular Formula | C21H23BrN2O4S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 4-bromo-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N-(2-methylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(C)(C)N(C1CC(=O)N(c2ccccc2)C1=O)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H23BrN2O4S/c1-4-21(2,3)24(29(27,28)17-12-10-15(22)11-13-17)18-14-19(25)23(20(18)26)16-8-6-5-7-9-16/h5-13,18H,4,14H2,1-3H3 |
| InChIKey | CAEXACIDGBOLHD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|