C21H22F2N2O4S — CID 23998726
4-fluoro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)benzenesulfonamide (PubChem CID 23998726) has the molecular formula C21H22F2N2O4S and a molecular weight of 436.48 g/mol. Its IUPAC name is 4-fluoro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 23998726 |
| Molecular Formula | C21H22F2N2O4S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 4-fluoro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-methylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(C)(C)N(C1CC(=O)N(c2ccc(F)cc2)C1=O)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22F2N2O4S/c1-4-21(2,3)25(30(28,29)17-11-7-15(23)8-12-17)18-13-19(26)24(20(18)27)16-9-5-14(22)6-10-16/h5-12,18H,4,13H2,1-3H3 |
| InChIKey | CGBUVRTXXSKKAP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|