C14H15NO2S2 — CID 100547015
N-(2-methylphenyl)-N-prop-2-enylthiophene-2-sulfonamide (PubChem CID 100547015) has the molecular formula C14H15NO2S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-(2-methylphenyl)-N-prop-2-enylthiophene-2-sulfonamide.
| Compound Name | N-(2-methylphenyl)-N-prop-2-enylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 100547015 |
| Molecular Formula | C14H15NO2S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N-(2-methylphenyl)-N-prop-2-enylthiophene-2-sulfonamide |
| SMILES | C=CCN(c1ccccc1C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H15NO2S2/c1-3-10-15(13-8-5-4-7-12(13)2)19(16,17)14-9-6-11-18-14/h3-9,11H,1,10H2,2H3 |
| InChIKey | SAJGXCSXQQIXAN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|