C22H24N2O4S2 — CID 2107882
2-[butyl(thiophen-2-ylsulfonyl)amino]-N-(4-phenoxyphenyl)acetamide (PubChem CID 2107882) has the molecular formula C22H24N2O4S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[butyl(thiophen-2-ylsulfonyl)amino]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[butyl(thiophen-2-ylsulfonyl)amino]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2107882 |
| Molecular Formula | C22H24N2O4S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-[butyl(thiophen-2-ylsulfonyl)amino]-N-(4-phenoxyphenyl)acetamide |
| SMILES | CCCCN(CC(=O)Nc1ccc(Oc2ccccc2)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C22H24N2O4S2/c1-2-3-15-24(30(26,27)22-10-7-16-29-22)17-21(25)23-18-11-13-20(14-12-18)28-19-8-5-4-6-9-19/h4-14,16H,2-3,15,17H2,1H3,(H,23,25) |
| InChIKey | QLESIYPAIAOHCG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |