C20H18F2N2O5S2 — CID 29221704
N-[4-(difluoromethoxy)phenyl]-2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 29221704) has the molecular formula C20H18F2N2O5S2 and a molecular weight of 468.50 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 29221704 |
| Molecular Formula | C20H18F2N2O5S2 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | COc1ccccc1N(CC(=O)Nc1ccc(OC(F)F)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H18F2N2O5S2/c1-28-17-6-3-2-5-16(17)24(31(26,27)19-7-4-12-30-19)13-18(25)23-14-8-10-15(11-9-14)29-20(21)22/h2-12,20H,13H2,1H3,(H,23,25) |
| InChIKey | DGCHVPLSNLGWFP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |