C20H19ClN2O4S2 — CID 29221629
N-[(4-chlorophenyl)methyl]-2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 29221629) has the molecular formula C20H19ClN2O4S2 and a molecular weight of 450.97 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 29221629 |
| Molecular Formula | C20H19ClN2O4S2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | COc1ccccc1N(CC(=O)NCc1ccc(Cl)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H19ClN2O4S2/c1-27-18-6-3-2-5-17(18)23(29(25,26)20-7-4-12-28-20)14-19(24)22-13-15-8-10-16(21)11-9-15/h2-12H,13-14H2,1H3,(H,22,24) |
| InChIKey | GBLHQEFBXXJSPV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |