C25H24N2O4S2 — CID 30803668
2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide (PubChem CID 30803668) has the molecular formula C25H24N2O4S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide.
| Compound Name | 2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 30803668 |
| Molecular Formula | C25H24N2O4S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 2-(2-methoxy-N-thiophen-2-ylsulfonylanilino)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
| SMILES | COc1ccccc1N(CC(=O)N[C@@H](C)c1ccc2ccccc2c1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C25H24N2O4S2/c1-18(20-14-13-19-8-3-4-9-21(19)16-20)26-24(28)17-27(22-10-5-6-11-23(22)31-2)33(29,30)25-12-7-15-32-25/h3-16,18H,17H2,1-2H3,(H,26,28)/t18-/m0/s1 |
| InChIKey | QEKJAHSRCMIFLG-SFHVURJKSA-N |
| XLogP | 4.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |