C21H21FN2O4S2 — CID 78839418
2-(N-(4-fluorophenyl)sulfonyl-2-methoxyanilino)-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 78839418) has the molecular formula C21H21FN2O4S2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-(N-(4-fluorophenyl)sulfonyl-2-methoxyanilino)-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(N-(4-fluorophenyl)sulfonyl-2-methoxyanilino)-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 78839418 |
| Molecular Formula | C21H21FN2O4S2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 2-(N-(4-fluorophenyl)sulfonyl-2-methoxyanilino)-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | COc1ccccc1N(CC(=O)NC(C)c1cccs1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN2O4S2/c1-15(20-8-5-13-29-20)23-21(25)14-24(18-6-3-4-7-19(18)28-2)30(26,27)17-11-9-16(22)10-12-17/h3-13,15H,14H2,1-2H3,(H,23,25) |
| InChIKey | GFOGMSZASXXVPF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |