C27H39N3O4 — CID 69400815
ethyl 2-[methyl-[3-[methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]amino]propyl]amino]hexanoate (PubChem CID 69400815) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is ethyl 2-[methyl-[3-[methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]amino]propyl]amino]hexanoate.
| Compound Name | ethyl 2-[methyl-[3-[methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]amino]propyl]amino]hexanoate |
|---|---|
| PubChem CID | 69400815 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | ethyl 2-[methyl-[3-[methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]amino]propyl]amino]hexanoate |
| SMILES | CCCCC(C(=O)OCC)N(C)CCCN(C)CC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H39N3O4/c1-5-7-14-25(27(32)33-6-2)30(4)20-11-19-29(3)21-26(31)28-22-15-17-24(18-16-22)34-23-12-9-8-10-13-23/h8-10,12-13,15-18,25H,5-7,11,14,19-21H2,1-4H3,(H,28,31) |
| InChIKey | YBQDPJJURHTDGP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |