C19H17FN2O4S2 — CID 16547796
N-(4-fluorophenyl)-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide (PubChem CID 16547796) has the molecular formula C19H17FN2O4S2 and a molecular weight of 420.49 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 16547796 |
| Molecular Formula | C19H17FN2O4S2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
| SMILES | CN(c1ccc(OCC(=O)Nc2ccc(F)cc2)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H17FN2O4S2/c1-22(28(24,25)19-3-2-12-27-19)16-8-10-17(11-9-16)26-13-18(23)21-15-6-4-14(20)5-7-15/h2-12H,13H2,1H3,(H,21,23) |
| InChIKey | OBLNRUNIJWSVTI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |