C23H23N3O5S2 — CID 55879849
N-[3-(3-cyanopropoxy)phenyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide (PubChem CID 55879849) has the molecular formula C23H23N3O5S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[3-(3-cyanopropoxy)phenyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide.
| Compound Name | N-[3-(3-cyanopropoxy)phenyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 55879849 |
| Molecular Formula | C23H23N3O5S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | N-[3-(3-cyanopropoxy)phenyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
| SMILES | CN(c1ccc(OCC(=O)Nc2cccc(OCCCC#N)c2)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C23H23N3O5S2/c1-26(33(28,29)23-8-5-15-32-23)19-9-11-20(12-10-19)31-17-22(27)25-18-6-4-7-21(16-18)30-14-3-2-13-24/h4-12,15-16H,2-3,14,17H2,1H3,(H,25,27) |
| InChIKey | BVWJYJFEUFSLQV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|