C16H21N3O4S2 — CID 120506152
N-[(2S)-1-aminopropan-2-yl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide (PubChem CID 120506152) has the molecular formula C16H21N3O4S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 120506152 |
| Molecular Formula | C16H21N3O4S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
| SMILES | C[C@@H](CN)NC(=O)COc1ccc(N(C)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C16H21N3O4S2/c1-12(10-17)18-15(20)11-23-14-7-5-13(6-8-14)19(2)25(21,22)16-4-3-9-24-16/h3-9,12H,10-11,17H2,1-2H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | HNGKPDXZJXSMKZ-LBPRGKRZSA-N |
| XLogP | 1.42 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |