C15H16N2O6S2 — CID 8820335
(2-amino-2-oxoethyl) 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate (PubChem CID 8820335) has the molecular formula C15H16N2O6S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate.
| Compound Name | (2-amino-2-oxoethyl) 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 8820335 |
| Molecular Formula | C15H16N2O6S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate |
| SMILES | CN(c1ccc(OCC(=O)OCC(N)=O)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H16N2O6S2/c1-17(25(20,21)15-3-2-8-24-15)11-4-6-12(7-5-11)22-10-14(19)23-9-13(16)18/h2-8H,9-10H2,1H3,(H2,16,18) |
| InChIKey | DHWVQAIYMIIGMJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |