C18H23NO5S2 — CID 30138427
3-methylbutyl 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate (PubChem CID 30138427) has the molecular formula C18H23NO5S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-methylbutyl 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate.
| Compound Name | 3-methylbutyl 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 30138427 |
| Molecular Formula | C18H23NO5S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-methylbutyl 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate |
| SMILES | CC(C)CCOC(=O)COc1ccc(N(C)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H23NO5S2/c1-14(2)10-11-23-17(20)13-24-16-8-6-15(7-9-16)19(3)26(21,22)18-5-4-12-25-18/h4-9,12,14H,10-11,13H2,1-3H3 |
| InChIKey | DGFVQADAKPPERT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |