C20H20N4O5S2 — CID 33152745
N-[4-(carbamoylamino)phenyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide (PubChem CID 33152745) has the molecular formula C20H20N4O5S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is N-[4-(carbamoylamino)phenyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide.
| Compound Name | N-[4-(carbamoylamino)phenyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 33152745 |
| Molecular Formula | C20H20N4O5S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-[4-(carbamoylamino)phenyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
| SMILES | CN(c1ccc(OCC(=O)Nc2ccc(NC(N)=O)cc2)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H20N4O5S2/c1-24(31(27,28)19-3-2-12-30-19)16-8-10-17(11-9-16)29-13-18(25)22-14-4-6-15(7-5-14)23-20(21)26/h2-12H,13H2,1H3,(H,22,25)(H3,21,23,26) |
| InChIKey | LJHLGGSDZYRDSY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |