C20H19BrN2O4S2 — CID 16545387
N-(4-bromo-3-methylphenyl)-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide (PubChem CID 16545387) has the molecular formula C20H19BrN2O4S2 and a molecular weight of 495.42 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 16545387 |
| Molecular Formula | C20H19BrN2O4S2 |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
| SMILES | Cc1cc(NC(=O)COc2ccc(N(C)S(=O)(=O)c3cccs3)cc2)ccc1Br |
| InChI | InChI=1S/C20H19BrN2O4S2/c1-14-12-15(5-10-18(14)21)22-19(24)13-27-17-8-6-16(7-9-17)23(2)29(25,26)20-4-3-11-28-20/h3-12H,13H2,1-2H3,(H,22,24) |
| InChIKey | MEYNXUQTMODMDS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |