C16H18BrFN2OS — CID 18191770
2-[(5-bromothiophen-2-yl)methyl-ethylamino]-N-(5-fluoro-2-methylphenyl)acetamide (PubChem CID 18191770) has the molecular formula C16H18BrFN2OS and a molecular weight of 385.30 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl-ethylamino]-N-(5-fluoro-2-methylphenyl)acetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl-ethylamino]-N-(5-fluoro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18191770 |
| Molecular Formula | C16H18BrFN2OS |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl-ethylamino]-N-(5-fluoro-2-methylphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1cc(F)ccc1C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C16H18BrFN2OS/c1-3-20(9-13-6-7-15(17)22-13)10-16(21)19-14-8-12(18)5-4-11(14)2/h4-8H,3,9-10H2,1-2H3,(H,19,21) |
| InChIKey | DVOBOILTGIHGQQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |