C9H11FN2O — CID 24700155
2-amino-N-(5-fluoro-2-methylphenyl)acetamide (PubChem CID 24700155) has the molecular formula C9H11FN2O and a molecular weight of 182.20 g/mol. Its IUPAC name is 2-amino-N-(5-fluoro-2-methylphenyl)acetamide.
| Compound Name | 2-amino-N-(5-fluoro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 24700155 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-amino-N-(5-fluoro-2-methylphenyl)acetamide |
| SMILES | Cc1ccc(F)cc1NC(=O)CN |
| InChI | InChI=1S/C9H11FN2O/c1-6-2-3-7(10)4-8(6)12-9(13)5-11/h2-4H,5,11H2,1H3,(H,12,13) |
| InChIKey | BGDTTYPNQBSNCU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |