C12H20FN3O — CID 142142758
2-amino-N-(2-amino-5-fluorophenyl)acetamide;2-methylpropane (PubChem CID 142142758) has the molecular formula C12H20FN3O and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-amino-N-(2-amino-5-fluorophenyl)acetamide;2-methylpropane.
| Compound Name | 2-amino-N-(2-amino-5-fluorophenyl)acetamide;2-methylpropane |
|---|---|
| PubChem CID | 142142758 |
| Molecular Formula | C12H20FN3O |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-amino-N-(2-amino-5-fluorophenyl)acetamide;2-methylpropane |
| SMILES | CC(C)C.NCC(=O)Nc1cc(F)ccc1N |
| InChI | InChI=1S/C8H10FN3O.C4H10/c9-5-1-2-6(11)7(3-5)12-8(13)4-10;1-4(2)3/h1-3H,4,10-11H2,(H,12,13);4H,1-3H3 |
| InChIKey | MBLBCWSXULFVSR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|