C15H23FN2O — CID 55169548
N-(2-amino-5-fluorophenyl)-3,5,5-trimethylhexanamide (PubChem CID 55169548) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-3,5,5-trimethylhexanamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 55169548 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)Nc1cc(F)ccc1N)CC(C)(C)C |
| InChI | InChI=1S/C15H23FN2O/c1-10(9-15(2,3)4)7-14(19)18-13-8-11(16)5-6-12(13)17/h5-6,8,10H,7,9,17H2,1-4H3,(H,18,19) |
| InChIKey | LNZPEELWESRTTK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|