C15H21F2NO2 — CID 90956806
N-(3,4-difluoro-2-hydroxyphenyl)-3,5,5-trimethylhexanamide (PubChem CID 90956806) has the molecular formula C15H21F2NO2 and a molecular weight of 285.33 g/mol. Its IUPAC name is N-(3,4-difluoro-2-hydroxyphenyl)-3,5,5-trimethylhexanamide.
| Compound Name | N-(3,4-difluoro-2-hydroxyphenyl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 90956806 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-(3,4-difluoro-2-hydroxyphenyl)-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)Nc1ccc(F)c(F)c1O)CC(C)(C)C |
| InChI | InChI=1S/C15H21F2NO2/c1-9(8-15(2,3)4)7-12(19)18-11-6-5-10(16)13(17)14(11)20/h5-6,9,20H,7-8H2,1-4H3,(H,18,19) |
| InChIKey | XQQAORWWILZZCE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|