C22H25ClN2O2S — CID 142673911
N-[3-(1,3-benzothiazol-2-yl)-5-chloro-2-hydroxyphenyl]-3,5,5-trimethylhexanamide (PubChem CID 142673911) has the molecular formula C22H25ClN2O2S and a molecular weight of 416.97 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-5-chloro-2-hydroxyphenyl]-3,5,5-trimethylhexanamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-5-chloro-2-hydroxyphenyl]-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 142673911 |
| Molecular Formula | C22H25ClN2O2S |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-5-chloro-2-hydroxyphenyl]-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)Nc1cc(Cl)cc(-c2nc3ccccc3s2)c1O)CC(C)(C)C |
| InChI | InChI=1S/C22H25ClN2O2S/c1-13(12-22(2,3)4)9-19(26)24-17-11-14(23)10-15(20(17)27)21-25-16-7-5-6-8-18(16)28-21/h5-8,10-11,13,27H,9,12H2,1-4H3,(H,24,26) |
| InChIKey | VVVJPODKJFOXQC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|