C16H24BrNO — CID 43321101
N-(4-bromo-3-methylphenyl)-3,5,5-trimethylhexanamide (PubChem CID 43321101) has the molecular formula C16H24BrNO and a molecular weight of 326.28 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-3,5,5-trimethylhexanamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 43321101 |
| Molecular Formula | C16H24BrNO |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-3,5,5-trimethylhexanamide |
| SMILES | Cc1cc(NC(=O)CC(C)CC(C)(C)C)ccc1Br |
| InChI | InChI=1S/C16H24BrNO/c1-11(10-16(3,4)5)8-15(19)18-13-6-7-14(17)12(2)9-13/h6-7,9,11H,8,10H2,1-5H3,(H,18,19) |
| InChIKey | PDPDJHMMNZFDGW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |