C15H23BrN2O — CID 83171017
N-(5-bromo-3-methyl-2-pyridinyl)-3,5,5-trimethylhexanamide (PubChem CID 83171017) has the molecular formula C15H23BrN2O and a molecular weight of 327.27 g/mol. Its IUPAC name is N-(5-bromo-3-methyl-2-pyridinyl)-3,5,5-trimethylhexanamide.
| Compound Name | N-(5-bromo-3-methyl-2-pyridinyl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 83171017 |
| Molecular Formula | C15H23BrN2O |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-(5-bromo-3-methyl-2-pyridinyl)-3,5,5-trimethylhexanamide |
| SMILES | Cc1cc(Br)cnc1NC(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C15H23BrN2O/c1-10(8-15(3,4)5)6-13(19)18-14-11(2)7-12(16)9-17-14/h7,9-10H,6,8H2,1-5H3,(H,17,18,19) |
| InChIKey | ARFBUDUMAPKDDT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |