C9H8BrF3N2O — CID 81489506
N-(5-bromo-3-methyl-2-pyridinyl)-3,3,3-trifluoropropanamide (PubChem CID 81489506) has the molecular formula C9H8BrF3N2O and a molecular weight of 297.07 g/mol. Its IUPAC name is N-(5-bromo-3-methyl-2-pyridinyl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(5-bromo-3-methyl-2-pyridinyl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 81489506 |
| Molecular Formula | C9H8BrF3N2O |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | N-(5-bromo-3-methyl-2-pyridinyl)-3,3,3-trifluoropropanamide |
| SMILES | Cc1cc(Br)cnc1NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H8BrF3N2O/c1-5-2-6(10)4-14-8(5)15-7(16)3-9(11,12)13/h2,4H,3H2,1H3,(H,14,15,16) |
| InChIKey | PAWOLAKOBOIGGI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |