C10H14BrN3O — CID 83170861
1-(5-bromo-3-methyl-2-pyridinyl)-3-propan-2-ylurea (PubChem CID 83170861) has the molecular formula C10H14BrN3O and a molecular weight of 272.15 g/mol. Its IUPAC name is 1-(5-bromo-3-methyl-2-pyridinyl)-3-propan-2-ylurea.
| Compound Name | 1-(5-bromo-3-methyl-2-pyridinyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 83170861 |
| Molecular Formula | C10H14BrN3O |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 1-(5-bromo-3-methyl-2-pyridinyl)-3-propan-2-ylurea |
| SMILES | Cc1cc(Br)cnc1NC(=O)NC(C)C |
| InChI | InChI=1S/C10H14BrN3O/c1-6(2)13-10(15)14-9-7(3)4-8(11)5-12-9/h4-6H,1-3H3,(H2,12,13,14,15) |
| InChIKey | MEGSXIUJTJWGIE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |