C12H17BrN2O2 — CID 79718493
methyl 2-[(5-bromo-3-methyl-2-pyridinyl)amino]-3-methylbutanoate (PubChem CID 79718493) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is methyl 2-[(5-bromo-3-methyl-2-pyridinyl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(5-bromo-3-methyl-2-pyridinyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 79718493 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | methyl 2-[(5-bromo-3-methyl-2-pyridinyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(Nc1ncc(Br)cc1C)C(C)C |
| InChI | InChI=1S/C12H17BrN2O2/c1-7(2)10(12(16)17-4)15-11-8(3)5-9(13)6-14-11/h5-7,10H,1-4H3,(H,14,15) |
| InChIKey | GPTZTVYFYYSRLF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |