C12H19BrN2O — CID 106350476
3-[(5-bromo-3-methyl-2-pyridinyl)amino]-4-methylpentan-1-ol (PubChem CID 106350476) has the molecular formula C12H19BrN2O and a molecular weight of 287.20 g/mol. Its IUPAC name is 3-[(5-bromo-3-methyl-2-pyridinyl)amino]-4-methylpentan-1-ol.
| Compound Name | 3-[(5-bromo-3-methyl-2-pyridinyl)amino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 106350476 |
| Molecular Formula | C12H19BrN2O |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-[(5-bromo-3-methyl-2-pyridinyl)amino]-4-methylpentan-1-ol |
| SMILES | Cc1cc(Br)cnc1NC(CCO)C(C)C |
| InChI | InChI=1S/C12H19BrN2O/c1-8(2)11(4-5-16)15-12-9(3)6-10(13)7-14-12/h6-8,11,16H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | WXOYRXWOXJHMEX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |