C15H19BrN2O — CID 96514670
(3R)-3-[(7-bromoquinolin-4-yl)amino]-4-methylpentan-1-ol (PubChem CID 96514670) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is (3R)-3-[(7-bromoquinolin-4-yl)amino]-4-methylpentan-1-ol.
| Compound Name | (3R)-3-[(7-bromoquinolin-4-yl)amino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 96514670 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (3R)-3-[(7-bromoquinolin-4-yl)amino]-4-methylpentan-1-ol |
| SMILES | CC(C)[C@@H](CCO)Nc1ccnc2cc(Br)ccc12 |
| InChI | InChI=1S/C15H19BrN2O/c1-10(2)13(6-8-19)18-14-5-7-17-15-9-11(16)3-4-12(14)15/h3-5,7,9-10,13,19H,6,8H2,1-2H3,(H,17,18)/t13-/m1/s1 |
| InChIKey | GTQMVQNQVYQQCK-CYBMUJFWSA-N |
| XLogP | 3.82 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |