C11H17ClN2O — CID 103757100
3-[(2-chloro-4-pyridinyl)amino]-4-methylpentan-1-ol (PubChem CID 103757100) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 3-[(2-chloro-4-pyridinyl)amino]-4-methylpentan-1-ol.
| Compound Name | 3-[(2-chloro-4-pyridinyl)amino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 103757100 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-[(2-chloro-4-pyridinyl)amino]-4-methylpentan-1-ol |
| SMILES | CC(C)C(CCO)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H17ClN2O/c1-8(2)10(4-6-15)14-9-3-5-13-11(12)7-9/h3,5,7-8,10,15H,4,6H2,1-2H3,(H,13,14) |
| InChIKey | VGYCXTSFOMEXKW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|