C11H19N3O — CID 103703910
4-methyl-3-[(4-methylpyrimidin-2-yl)amino]pentan-1-ol (PubChem CID 103703910) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-methyl-3-[(4-methylpyrimidin-2-yl)amino]pentan-1-ol.
| Compound Name | 4-methyl-3-[(4-methylpyrimidin-2-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 103703910 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-methyl-3-[(4-methylpyrimidin-2-yl)amino]pentan-1-ol |
| SMILES | Cc1ccnc(NC(CCO)C(C)C)n1 |
| InChI | InChI=1S/C11H19N3O/c1-8(2)10(5-7-15)14-11-12-6-4-9(3)13-11/h4,6,8,10,15H,5,7H2,1-3H3,(H,12,13,14) |
| InChIKey | TXBXLQCKXILKTE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |