C9H15N3S — CID 115637582
4-methyl-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine (PubChem CID 115637582) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 4-methyl-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine.
| Compound Name | 4-methyl-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 115637582 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4-methyl-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine |
| SMILES | CSCC(C)Nc1nccc(C)n1 |
| InChI | InChI=1S/C9H15N3S/c1-7-4-5-10-9(11-7)12-8(2)6-13-3/h4-5,8H,6H2,1-3H3,(H,10,11,12) |
| InChIKey | XHQMGJHQGNXSGI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |