C14H16FN3OS — CID 133311843
4-(4-fluorophenoxy)-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine (PubChem CID 133311843) has the molecular formula C14H16FN3OS and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine.
| Compound Name | 4-(4-fluorophenoxy)-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 133311843 |
| Molecular Formula | C14H16FN3OS |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine |
| SMILES | CSCC(C)Nc1nccc(Oc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H16FN3OS/c1-10(9-20-2)17-14-16-8-7-13(18-14)19-12-5-3-11(15)4-6-12/h3-8,10H,9H2,1-2H3,(H,16,17,18) |
| InChIKey | WXIBFOXGHSQJNE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |