C22H16F2N4O — CID 133415948
4-(4-fluorophenoxy)-N-[(3-fluorophenyl)-pyridin-2-ylmethyl]pyrimidin-2-amine (PubChem CID 133415948) has the molecular formula C22H16F2N4O and a molecular weight of 390.39 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-[(3-fluorophenyl)-pyridin-2-ylmethyl]pyrimidin-2-amine.
| Compound Name | 4-(4-fluorophenoxy)-N-[(3-fluorophenyl)-pyridin-2-ylmethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 133415948 |
| Molecular Formula | C22H16F2N4O |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-[(3-fluorophenyl)-pyridin-2-ylmethyl]pyrimidin-2-amine |
| SMILES | Fc1ccc(Oc2ccnc(NC(c3cccc(F)c3)c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C22H16F2N4O/c23-16-7-9-18(10-8-16)29-20-11-13-26-22(27-20)28-21(19-6-1-2-12-25-19)15-4-3-5-17(24)14-15/h1-14,21H,(H,26,27,28) |
| InChIKey | YKLRRBVLSWGQOQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |