C17H15FN4O — CID 133415900
N-[(3-fluorophenyl)-pyridin-2-ylmethyl]-4-methoxypyrimidin-2-amine (PubChem CID 133415900) has the molecular formula C17H15FN4O and a molecular weight of 310.33 g/mol. Its IUPAC name is N-[(3-fluorophenyl)-pyridin-2-ylmethyl]-4-methoxypyrimidin-2-amine.
| Compound Name | N-[(3-fluorophenyl)-pyridin-2-ylmethyl]-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 133415900 |
| Molecular Formula | C17H15FN4O |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-[(3-fluorophenyl)-pyridin-2-ylmethyl]-4-methoxypyrimidin-2-amine |
| SMILES | COc1ccnc(NC(c2cccc(F)c2)c2ccccn2)n1 |
| InChI | InChI=1S/C17H15FN4O/c1-23-15-8-10-20-17(21-15)22-16(14-7-2-3-9-19-14)12-5-4-6-13(18)11-12/h2-11,16H,1H3,(H,20,21,22) |
| InChIKey | ZMTCYTICFXRGNL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |