C8H12N4O — CID 62959080
2-[(4-methylpyrimidin-2-yl)amino]propanamide (PubChem CID 62959080) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-[(4-methylpyrimidin-2-yl)amino]propanamide.
| Compound Name | 2-[(4-methylpyrimidin-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 62959080 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-[(4-methylpyrimidin-2-yl)amino]propanamide |
| SMILES | Cc1ccnc(NC(C)C(N)=O)n1 |
| InChI | InChI=1S/C8H12N4O/c1-5-3-4-10-8(11-5)12-6(2)7(9)13/h3-4,6H,1-2H3,(H2,9,13)(H,10,11,12) |
| InChIKey | PSTSYGFEPFGONB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |