C13H15BrN2O — CID 165134506
1-[(7-bromoquinolin-4-yl)amino]-2-methylpropan-2-ol (PubChem CID 165134506) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 1-[(7-bromoquinolin-4-yl)amino]-2-methylpropan-2-ol.
| Compound Name | 1-[(7-bromoquinolin-4-yl)amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 165134506 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 1-[(7-bromoquinolin-4-yl)amino]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CNc1ccnc2cc(Br)ccc12 |
| InChI | InChI=1S/C13H15BrN2O/c1-13(2,17)8-16-11-5-6-15-12-7-9(14)3-4-10(11)12/h3-7,17H,8H2,1-2H3,(H,15,16) |
| InChIKey | ZVPZXAGPZZULKM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |