C13H9BrF3N3O — CID 115739184
N-(5-bromo-3-methyl-2-pyridinyl)-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 115739184) has the molecular formula C13H9BrF3N3O and a molecular weight of 360.13 g/mol. Its IUPAC name is N-(5-bromo-3-methyl-2-pyridinyl)-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(5-bromo-3-methyl-2-pyridinyl)-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 115739184 |
| Molecular Formula | C13H9BrF3N3O |
| Molecular Weight | 360.13 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | N-(5-bromo-3-methyl-2-pyridinyl)-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(Br)cnc1NC(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H9BrF3N3O/c1-7-4-9(14)6-19-11(7)20-12(21)10-3-2-8(5-18-10)13(15,16)17/h2-6H,1H3,(H,19,20,21) |
| InChIKey | LTFPGVMPANWJQB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.13 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |