C13H23N3O — CID 60974660
3,5,5-trimethyl-N-(5-methyl-1H-pyrazol-3-yl)hexanamide (PubChem CID 60974660) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3,5,5-trimethyl-N-(5-methyl-1H-pyrazol-3-yl)hexanamide.
| Compound Name | 3,5,5-trimethyl-N-(5-methyl-1H-pyrazol-3-yl)hexanamide |
|---|---|
| PubChem CID | 60974660 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3,5,5-trimethyl-N-(5-methyl-1H-pyrazol-3-yl)hexanamide |
| SMILES | Cc1cc(NC(=O)CC(C)CC(C)(C)C)n[nH]1 |
| InChI | InChI=1S/C13H23N3O/c1-9(8-13(3,4)5)6-12(17)14-11-7-10(2)15-16-11/h7,9H,6,8H2,1-5H3,(H2,14,15,16,17) |
| InChIKey | FILYPVFHVPTCEA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |