C15H12BrClFNOS — CID 107952045
3-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4-fluoro-N-prop-2-enylbenzamide (PubChem CID 107952045) has the molecular formula C15H12BrClFNOS and a molecular weight of 388.69 g/mol. Its IUPAC name is 3-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4-fluoro-N-prop-2-enylbenzamide.
| Compound Name | 3-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4-fluoro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 107952045 |
| Molecular Formula | C15H12BrClFNOS |
| Molecular Weight | 388.69 g/mol |
| Exact Mass | 386.95 |
| IUPAC Name | 3-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4-fluoro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C15H12BrClFNOS/c1-2-7-19(9-11-4-6-14(17)21-11)15(20)10-3-5-13(18)12(16)8-10/h2-6,8H,1,7,9H2 |
| InChIKey | BBLMGBWRVXSVHF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.69 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|