C16H15BrClNOS — CID 81109883
2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-5-methyl-N-prop-2-enylbenzamide (PubChem CID 81109883) has the molecular formula C16H15BrClNOS and a molecular weight of 384.73 g/mol. Its IUPAC name is 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-5-methyl-N-prop-2-enylbenzamide.
| Compound Name | 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-5-methyl-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 81109883 |
| Molecular Formula | C16H15BrClNOS |
| Molecular Weight | 384.73 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-5-methyl-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1cc(C)ccc1Br |
| InChI | InChI=1S/C16H15BrClNOS/c1-3-8-19(10-12-5-7-15(18)21-12)16(20)13-9-11(2)4-6-14(13)17/h3-7,9H,1,8,10H2,2H3 |
| InChIKey | ANANKNDAGNXMEB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.73 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|