C16H14ClNO3S — CID 78792313
N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-benzodioxole-5-carboxamide (PubChem CID 78792313) has the molecular formula C16H14ClNO3S and a molecular weight of 335.81 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 78792313 |
| Molecular Formula | C16H14ClNO3S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-benzodioxole-5-carboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14ClNO3S/c1-2-7-18(9-12-4-6-15(17)22-12)16(19)11-3-5-13-14(8-11)21-10-20-13/h2-6,8H,1,7,9-10H2 |
| InChIKey | FWLUMTMDYVRIDV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|