C18H16ClN3O2S2 — CID 33197909
N-[(5-chlorothiophen-2-yl)methyl]-3-methyl-4-oxo-N-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 33197909) has the molecular formula C18H16ClN3O2S2 and a molecular weight of 405.93 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-3-methyl-4-oxo-N-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-3-methyl-4-oxo-N-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 33197909 |
| Molecular Formula | C18H16ClN3O2S2 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-3-methyl-4-oxo-N-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1ccc2c(=O)n(C)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C18H16ClN3O2S2/c1-3-8-22(10-12-5-7-15(19)26-12)16(23)11-4-6-13-14(9-11)20-18(25)21(2)17(13)24/h3-7,9H,1,8,10H2,2H3,(H,20,25) |
| InChIKey | VPVFBXIWDCXTIC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|