C14H12ClFN2OS — CID 63973559
N-[(5-chlorothiophen-2-yl)methyl]-6-fluoro-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 63973559) has the molecular formula C14H12ClFN2OS and a molecular weight of 310.78 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-6-fluoro-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-6-fluoro-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 63973559 |
| Molecular Formula | C14H12ClFN2OS |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-6-fluoro-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C14H12ClFN2OS/c1-2-7-18(9-11-4-5-12(15)20-11)14(19)10-3-6-13(16)17-8-10/h2-6,8H,1,7,9H2 |
| InChIKey | YIIAQCQCSCZUEF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|